C12H12Cl2INO3S — CID 43238697
2-[(3,5-dichloro-2-iodobenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 43238697) has the molecular formula C12H12Cl2INO3S and a molecular weight of 448.11 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-iodobenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(3,5-dichloro-2-iodobenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43238697 |
| Molecular Formula | C12H12Cl2INO3S |
| Molecular Weight | 448.11 g/mol |
| Exact Mass | 446.90 |
| IUPAC Name | 2-[(3,5-dichloro-2-iodobenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1cc(Cl)cc(Cl)c1I)C(=O)O |
| InChI | InChI=1S/C12H12Cl2INO3S/c1-20-3-2-9(12(18)19)16-11(17)7-4-6(13)5-8(14)10(7)15/h4-5,9H,2-3H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QELGJDPIVBPTGS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|