C19H20INO3S — CID 22001394
2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22001394) has the molecular formula C19H20INO3S and a molecular weight of 469.34 g/mol. Its IUPAC name is 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22001394 |
| Molecular Formula | C19H20INO3S |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(I)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C19H20INO3S/c1-12-5-3-4-6-14(12)16-11-13(20)7-8-15(16)18(22)21-17(19(23)24)9-10-25-2/h3-8,11,17H,9-10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | QRVDOAPCTIDVRB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|