C29H33NO3S — CID 20649028
2-[[2-(2-methylphenyl)-4-(4-phenylbutyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20649028) has the molecular formula C29H33NO3S and a molecular weight of 475.65 g/mol. Its IUPAC name is 2-[[2-(2-methylphenyl)-4-(4-phenylbutyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2-methylphenyl)-4-(4-phenylbutyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20649028 |
| Molecular Formula | C29H33NO3S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-[[2-(2-methylphenyl)-4-(4-phenylbutyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(CCCCc2ccccc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C29H33NO3S/c1-21-10-6-9-15-24(21)26-20-23(14-8-7-13-22-11-4-3-5-12-22)16-17-25(26)28(31)30-27(29(32)33)18-19-34-2/h3-6,9-12,15-17,20,27H,7-8,13-14,18-19H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | XYPQXGDPIIOGEM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|