C28H32LiNO4S — CID 173281786
lithium;hydride;(2S)-2-[[2-(2-methylphenyl)-4-(2-phenylethoxymethyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 173281786) has the molecular formula C28H32LiNO4S and a molecular weight of 485.58 g/mol. Its IUPAC name is lithium;hydride;(2S)-2-[[2-(2-methylphenyl)-4-(2-phenylethoxymethyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | lithium;hydride;(2S)-2-[[2-(2-methylphenyl)-4-(2-phenylethoxymethyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 173281786 |
| Molecular Formula | C28H32LiNO4S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | lithium;hydride;(2S)-2-[[2-(2-methylphenyl)-4-(2-phenylethoxymethyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(COCCc2ccccc2)cc1-c1ccccc1C)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C28H31NO4S.Li.H/c1-20-8-6-7-11-23(20)25-18-22(19-33-16-14-21-9-4-3-5-10-21)12-13-24(25)27(30)29-26(28(31)32)15-17-34-2;;/h3-13,18,26H,14-17,19H2,1-2H3,(H,29,30)(H,31,32);;/q;+1;-1/t26-;;/m0../s1 |
| InChIKey | HKCJNEKCPWVENB-ROPHLPQBSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|