C25H27LiNO4S2 — CID 70226529
CID 70226529 (PubChem CID 70226529) has the molecular formula C25H27LiNO4S2 and a molecular weight of 476.57 g/mol.
| Compound Name | CID 70226529 |
|---|---|
| PubChem CID | 70226529 |
| Molecular Formula | C25H27LiNO4S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | — |
| SMILES | CSCC[C@H](NC(=O)c1ccc(COCc2ccsc2)cc1-c1ccccc1C)C(=O)O.[Li] |
| InChI | InChI=1S/C25H27NO4S2.Li/c1-17-5-3-4-6-20(17)22-13-18(14-30-15-19-9-12-32-16-19)7-8-21(22)24(27)26-23(25(28)29)10-11-31-2;/h3-9,12-13,16,23H,10-11,14-15H2,1-2H3,(H,26,27)(H,28,29);/t23-;/m0./s1 |
| InChIKey | MIZIZZAIQIDKPE-BQAIUKQQSA-N |
| XLogP | 5.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |