C30H33NO3S — CID 70227692
(2S)-2-[[2-(2-methylphenyl)-4-(5-phenylpent-1-enyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 70227692) has the molecular formula C30H33NO3S and a molecular weight of 487.67 g/mol. Its IUPAC name is (2S)-2-[[2-(2-methylphenyl)-4-(5-phenylpent-1-enyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-(2-methylphenyl)-4-(5-phenylpent-1-enyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 70227692 |
| Molecular Formula | C30H33NO3S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (2S)-2-[[2-(2-methylphenyl)-4-(5-phenylpent-1-enyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(C=CCCCc2ccccc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C30H33NO3S/c1-22-11-9-10-16-25(22)27-21-24(15-8-4-7-14-23-12-5-3-6-13-23)17-18-26(27)29(32)31-28(30(33)34)19-20-35-2/h3,5-6,8-13,15-18,21,28H,4,7,14,19-20H2,1-2H3,(H,31,32)(H,33,34)/t28-/m0/s1 |
| InChIKey | JHGLFADLJVMLJL-NDEPHWFRSA-N |
| XLogP | 6.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|