C28H31NO4S — CID 22014254
2-[[2-(2-methylphenyl)-4-(3-phenylpropoxy)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22014254) has the molecular formula C28H31NO4S and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-[[2-(2-methylphenyl)-4-(3-phenylpropoxy)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2-methylphenyl)-4-(3-phenylpropoxy)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22014254 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[[2-(2-methylphenyl)-4-(3-phenylpropoxy)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(OCCCc2ccccc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C28H31NO4S/c1-20-9-6-7-13-23(20)25-19-22(33-17-8-12-21-10-4-3-5-11-21)14-15-24(25)27(30)29-26(28(31)32)16-18-34-2/h3-7,9-11,13-15,19,26H,8,12,16-18H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | BRYPUJRTHDUBRU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|