C34H44N2O3S — CID 90887372
(2S)-2-[[2-(2-methylphenyl)-4-[[pentyl(3-phenylpropyl)amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 90887372) has the molecular formula C34H44N2O3S and a molecular weight of 560.80 g/mol. Its IUPAC name is (2S)-2-[[2-(2-methylphenyl)-4-[[pentyl(3-phenylpropyl)amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-(2-methylphenyl)-4-[[pentyl(3-phenylpropyl)amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 90887372 |
| Molecular Formula | C34H44N2O3S |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (2S)-2-[[2-(2-methylphenyl)-4-[[pentyl(3-phenylpropyl)amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCCCN(CCCc1ccccc1)Cc1ccc(C(=O)N[C@@H](CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C34H44N2O3S/c1-4-5-11-21-36(22-12-16-27-14-7-6-8-15-27)25-28-18-19-30(31(24-28)29-17-10-9-13-26(29)2)33(37)35-32(34(38)39)20-23-40-3/h6-10,13-15,17-19,24,32H,4-5,11-12,16,20-23,25H2,1-3H3,(H,35,37)(H,38,39)/t32-/m0/s1 |
| InChIKey | SCMNUMGXBQAGRW-YTTGMZPUSA-N |
| XLogP | 7.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|