C29H39NO4S — CID 59949623
(2S)-2-[[4-(4-cyclohexylbutoxy)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 59949623) has the molecular formula C29H39NO4S and a molecular weight of 497.70 g/mol. Its IUPAC name is (2S)-2-[[4-(4-cyclohexylbutoxy)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-(4-cyclohexylbutoxy)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 59949623 |
| Molecular Formula | C29H39NO4S |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | (2S)-2-[[4-(4-cyclohexylbutoxy)-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(OCCCCC2CCCCC2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C29H39NO4S/c1-21-10-6-7-14-24(21)26-20-23(34-18-9-8-13-22-11-4-3-5-12-22)15-16-25(26)28(31)30-27(29(32)33)17-19-35-2/h6-7,10,14-16,20,22,27H,3-5,8-9,11-13,17-19H2,1-2H3,(H,30,31)(H,32,33)/t27-/m0/s1 |
| InChIKey | BSGAYVJSNMDGJB-MHZLTWQESA-N |
| XLogP | 6.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|