C31H42N2O4S — CID 54080186
(2S)-2-[[4-[3-(3-cyclohexylpropanoylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 54080186) has the molecular formula C31H42N2O4S and a molecular weight of 538.75 g/mol. Its IUPAC name is (2S)-2-[[4-[3-(3-cyclohexylpropanoylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[3-(3-cyclohexylpropanoylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54080186 |
| Molecular Formula | C31H42N2O4S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (2S)-2-[[4-[3-(3-cyclohexylpropanoylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CCCNC(=O)CCC2CCCCC2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C31H42N2O4S/c1-22-9-6-7-13-25(22)27-21-24(12-8-19-32-29(34)17-15-23-10-4-3-5-11-23)14-16-26(27)30(35)33-28(31(36)37)18-20-38-2/h6-7,9,13-14,16,21,23,28H,3-5,8,10-12,15,17-20H2,1-2H3,(H,32,34)(H,33,35)(H,36,37)/t28-/m0/s1 |
| InChIKey | MMOAGMKCAKJUJN-NDEPHWFRSA-N |
| XLogP | 6.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|