C28H36NO5PS — CID 70229467
CID 70229467 (PubChem CID 70229467) has the molecular formula C28H36NO5PS and a molecular weight of 529.64 g/mol.
| Compound Name | CID 70229467 |
|---|---|
| PubChem CID | 70229467 |
| Molecular Formula | C28H36NO5PS |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | — |
| SMILES | CSCCC(NC(=O)c1ccc(C(CCC2CCCCC2)P(=O)=O)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C28H36NO5PS/c1-19-8-6-7-11-22(19)24-18-21(26(35(33)34)15-12-20-9-4-3-5-10-20)13-14-23(24)27(30)29-25(28(31)32)16-17-36-2/h6-8,11,13-14,18,20,25-26H,3-5,9-10,12,15-17H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | OPIXRFPTHYQRPU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|