C30H42N2O3S — CID 10815574
ethyl (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 10815574) has the molecular formula C30H42N2O3S and a molecular weight of 510.74 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 10815574 |
| Molecular Formula | C30H42N2O3S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | ethyl (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@H](CCSC)NC(=O)c1ccc(CNCCC2CCCCC2)cc1-c1ccccc1C |
| InChI | InChI=1S/C30H42N2O3S/c1-4-35-30(34)28(17-19-36-3)32-29(33)26-15-14-24(20-27(26)25-13-9-8-10-22(25)2)21-31-18-16-23-11-6-5-7-12-23/h8-10,13-15,20,23,28,31H,4-7,11-12,16-19,21H2,1-3H3,(H,32,33)/t28-/m0/s1 |
| InChIKey | MTVMCGRFQUGERJ-NDEPHWFRSA-N |
| XLogP | 6.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|