C33H46N2O4S — CID 91057317
methyl (2S)-2-[[4-[3-(butylamino)-2-cyclohexyl-3-oxopropyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91057317) has the molecular formula C33H46N2O4S and a molecular weight of 566.81 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[3-(butylamino)-2-cyclohexyl-3-oxopropyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-[3-(butylamino)-2-cyclohexyl-3-oxopropyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91057317 |
| Molecular Formula | C33H46N2O4S |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | methyl (2S)-2-[[4-[3-(butylamino)-2-cyclohexyl-3-oxopropyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCNC(=O)C(Cc1ccc(C(=O)N[C@@H](CCSC)C(=O)OC)c(-c2ccccc2C)c1)C1CCCCC1 |
| InChI | InChI=1S/C33H46N2O4S/c1-5-6-19-34-31(36)28(25-13-8-7-9-14-25)21-24-16-17-27(29(22-24)26-15-11-10-12-23(26)2)32(37)35-30(18-20-40-4)33(38)39-3/h10-12,15-17,22,25,28,30H,5-9,13-14,18-21H2,1-4H3,(H,34,36)(H,35,37)/t28?,30-/m0/s1 |
| InChIKey | JPHIOGWAPOJZLH-TXDWVUBVSA-N |
| XLogP | 6.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|