C29H40N2O3S — CID 20699770
methyl 2-[[4-[3-(cyclohexylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20699770) has the molecular formula C29H40N2O3S and a molecular weight of 496.72 g/mol. Its IUPAC name is methyl 2-[[4-[3-(cyclohexylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[4-[3-(cyclohexylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20699770 |
| Molecular Formula | C29H40N2O3S |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | methyl 2-[[4-[3-(cyclohexylamino)propyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1ccc(CCCNC2CCCCC2)cc1-c1ccccc1C |
| InChI | InChI=1S/C29H40N2O3S/c1-21-10-7-8-14-24(21)26-20-22(11-9-18-30-23-12-5-4-6-13-23)15-16-25(26)28(32)31-27(17-19-35-3)29(33)34-2/h7-8,10,14-16,20,23,27,30H,4-6,9,11-13,17-19H2,1-3H3,(H,31,32) |
| InChIKey | XRCGVOBSSLEFEB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|