C28H37N2O3S- — CID 91931203
(2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91931203) has the molecular formula C28H37N2O3S- and a molecular weight of 481.68 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91931203 |
| Molecular Formula | C28H37N2O3S- |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (2S)-2-[[4-[(2-cyclohexylethylamino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CNCCC2CCCCC2)cc1-c1ccccc1C)C(=O)[O-] |
| InChI | InChI=1S/C28H38N2O3S/c1-20-8-6-7-11-23(20)25-18-22(19-29-16-14-21-9-4-3-5-10-21)12-13-24(25)27(31)30-26(28(32)33)15-17-34-2/h6-8,11-13,18,21,26,29H,3-5,9-10,14-17,19H2,1-2H3,(H,30,31)(H,32,33)/p-1/t26-/m0/s1 |
| InChIKey | AITRSUMFMXLCFQ-SANMLTNESA-M |
| XLogP | 4.32 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|