C35H44LiNO5S2 — CID 173282447
lithium;(2S)-2-[[4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;hydride (PubChem CID 173282447) has the molecular formula C35H44LiNO5S2 and a molecular weight of 629.81 g/mol. Its IUPAC name is lithium;(2S)-2-[[4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;hydride.
| Compound Name | lithium;(2S)-2-[[4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;hydride |
|---|---|
| PubChem CID | 173282447 |
| Molecular Formula | C35H44LiNO5S2 |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | lithium;(2S)-2-[[4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;hydride |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CC(CCC2CCCCC2)S(=O)(=O)c2ccccc2)cc1-c1ccccc1C)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C35H43NO5S2.Li.H/c1-25-11-9-10-16-30(25)32-24-27(18-20-31(32)34(37)36-33(35(38)39)21-22-42-2)23-29(19-17-26-12-5-3-6-13-26)43(40,41)28-14-7-4-8-15-28;;/h4,7-11,14-16,18,20,24,26,29,33H,3,5-6,12-13,17,19,21-23H2,1-2H3,(H,36,37)(H,38,39);;/q;+1;-1/t29?,33-;;/m0../s1 |
| InChIKey | RUWPHBSJKYLSPH-QQLCWKIPSA-N |
| XLogP | 4.46 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |