C31H36O4S — CID 20649177
methyl 4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoate (PubChem CID 20649177) has the molecular formula C31H36O4S and a molecular weight of 504.69 g/mol. Its IUPAC name is methyl 4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 20649177 |
| Molecular Formula | C31H36O4S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl 4-[2-(benzenesulfonyl)-4-cyclohexylbutyl]-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(CC(CCC2CCCCC2)S(=O)(=O)c2ccccc2)cc1-c1ccccc1C |
| InChI | InChI=1S/C31H36O4S/c1-23-11-9-10-16-28(23)30-22-25(18-20-29(30)31(32)35-2)21-27(19-17-24-12-5-3-6-13-24)36(33,34)26-14-7-4-8-15-26/h4,7-11,14-16,18,20,22,24,27H,3,5-6,12-13,17,19,21H2,1-2H3 |
| InChIKey | HUABTNGWCQPTSZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |