C36H46LiN2O5S2 — CID 172865368
CID 172865368 (PubChem CID 172865368) has the molecular formula C36H46LiN2O5S2 and a molecular weight of 657.85 g/mol.
| Compound Name | CID 172865368 |
|---|---|
| PubChem CID | 172865368 |
| Molecular Formula | C36H46LiN2O5S2 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)c1ccc(CN(CCCC2CCCCC2)S(=O)(=O)c2ccccc2)cc1-c1ccccc1C.[Li] |
| InChI | InChI=1S/C36H46N2O5S2.Li/c1-27-13-10-11-19-31(27)33-25-29(20-21-32(33)35(39)37-34(22-24-44-3)36(40)43-2)26-38(23-12-16-28-14-6-4-7-15-28)45(41,42)30-17-8-5-9-18-30;/h5,8-11,13,17-21,25,28,34H,4,6-7,12,14-16,22-24,26H2,1-3H3,(H,37,39);/t34-;/m0./s1 |
| InChIKey | ZXMDGSZZWLIVTL-GXUZKUJRSA-N |
| XLogP | 6.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |