C35H44N2O5S2 — CID 20698963
(2S)-2-[[4-[[benzenesulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20698963) has the molecular formula C35H44N2O5S2 and a molecular weight of 636.88 g/mol. Its IUPAC name is (2S)-2-[[4-[[benzenesulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[benzenesulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20698963 |
| Molecular Formula | C35H44N2O5S2 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | (2S)-2-[[4-[[benzenesulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CN(CCCC2CCCCC2)S(=O)(=O)c2ccccc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C35H44N2O5S2/c1-26-12-9-10-18-30(26)32-24-28(19-20-31(32)34(38)36-33(35(39)40)21-23-43-2)25-37(22-11-15-27-13-5-3-6-14-27)44(41,42)29-16-7-4-8-17-29/h4,7-10,12,16-20,24,27,33H,3,5-6,11,13-15,21-23,25H2,1-2H3,(H,36,38)(H,39,40)/t33-/m0/s1 |
| InChIKey | OVUCYPCQLAYROR-XIFFEERXSA-N |
| XLogP | 7.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |