C31H35ClO3 — CID 59949296
methyl 4-[[1-(3-chlorophenyl)-3-cyclohexylpropoxy]methyl]-2-(2-methylphenyl)benzoate (PubChem CID 59949296) has the molecular formula C31H35ClO3 and a molecular weight of 491.07 g/mol. Its IUPAC name is methyl 4-[[1-(3-chlorophenyl)-3-cyclohexylpropoxy]methyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[[1-(3-chlorophenyl)-3-cyclohexylpropoxy]methyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 59949296 |
| Molecular Formula | C31H35ClO3 |
| Molecular Weight | 491.07 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | methyl 4-[[1-(3-chlorophenyl)-3-cyclohexylpropoxy]methyl]-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(COC(CCC2CCCCC2)c2cccc(Cl)c2)cc1-c1ccccc1C |
| InChI | InChI=1S/C31H35ClO3/c1-22-9-6-7-14-27(22)29-19-24(15-17-28(29)31(33)34-2)21-35-30(25-12-8-13-26(32)20-25)18-16-23-10-4-3-5-11-23/h6-9,12-15,17,19-20,23,30H,3-5,10-11,16,18,21H2,1-2H3 |
| InChIKey | DZTBUWFSUXYMJJ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.07 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |