C30H43NO4S — CID 20699904
methyl 4-[[butylsulfonyl(4-cyclohexylbutyl)amino]methyl]-2-(2-methylphenyl)benzoate (PubChem CID 20699904) has the molecular formula C30H43NO4S and a molecular weight of 513.74 g/mol. Its IUPAC name is methyl 4-[[butylsulfonyl(4-cyclohexylbutyl)amino]methyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[[butylsulfonyl(4-cyclohexylbutyl)amino]methyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 20699904 |
| Molecular Formula | C30H43NO4S |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | methyl 4-[[butylsulfonyl(4-cyclohexylbutyl)amino]methyl]-2-(2-methylphenyl)benzoate |
| SMILES | CCCCS(=O)(=O)N(CCCCC1CCCCC1)Cc1ccc(C(=O)OC)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C30H43NO4S/c1-4-5-21-36(33,34)31(20-12-11-16-25-14-7-6-8-15-25)23-26-18-19-28(30(32)35-3)29(22-26)27-17-10-9-13-24(27)2/h9-10,13,17-19,22,25H,4-8,11-12,14-16,20-21,23H2,1-3H3 |
| InChIKey | STYQKNLXMDBNGY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|