C28H38O3 — CID 59949640
methyl 4-[[(2R)-1-cyclohexylhexan-2-yl]oxymethyl]-2-(2-methylphenyl)benzoate (PubChem CID 59949640) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is methyl 4-[[(2R)-1-cyclohexylhexan-2-yl]oxymethyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[[(2R)-1-cyclohexylhexan-2-yl]oxymethyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 59949640 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | methyl 4-[[(2R)-1-cyclohexylhexan-2-yl]oxymethyl]-2-(2-methylphenyl)benzoate |
| SMILES | CCCC[C@H](CC1CCCCC1)OCc1ccc(C(=O)OC)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C28H38O3/c1-4-5-14-24(18-22-12-7-6-8-13-22)31-20-23-16-17-26(28(29)30-3)27(19-23)25-15-10-9-11-21(25)2/h9-11,15-17,19,22,24H,4-8,12-14,18,20H2,1-3H3/t24-/m1/s1 |
| InChIKey | ABFUNNNCICZCSR-XMMPIXPASA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |