C32H44N2O5S — CID 163924083
(2S)-2-[[4-[[butylsulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]but-3-enoic acid (PubChem CID 163924083) has the molecular formula C32H44N2O5S and a molecular weight of 568.78 g/mol. Its IUPAC name is (2S)-2-[[4-[[butylsulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]but-3-enoic acid.
| Compound Name | (2S)-2-[[4-[[butylsulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]but-3-enoic acid |
|---|---|
| PubChem CID | 163924083 |
| Molecular Formula | C32H44N2O5S |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2S)-2-[[4-[[butylsulfonyl(3-cyclohexylpropyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]but-3-enoic acid |
| SMILES | C=C[C@H](NC(=O)c1ccc(CN(CCCC2CCCCC2)S(=O)(=O)CCCC)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C32H44N2O5S/c1-4-6-21-40(38,39)34(20-12-16-25-14-8-7-9-15-25)23-26-18-19-28(31(35)33-30(5-2)32(36)37)29(22-26)27-17-11-10-13-24(27)3/h5,10-11,13,17-19,22,25,30H,2,4,6-9,12,14-16,20-21,23H2,1,3H3,(H,33,35)(H,36,37)/t30-/m0/s1 |
| InChIKey | RCYCMTAACXEIKY-PMERELPUSA-N |
| XLogP | 6.32 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|