C29H41N3O3 — CID 18361146
5-amino-2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]pentanoic acid (PubChem CID 18361146) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is 5-amino-2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-amino-2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18361146 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 5-amino-2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]pentanoic acid |
| SMILES | Cc1ccccc1-c1cc(CN(C)CCC2CCCCC2)ccc1C(=O)NC(CCCN)C(=O)O |
| InChI | InChI=1S/C29H41N3O3/c1-21-9-6-7-12-24(21)26-19-23(20-32(2)18-16-22-10-4-3-5-11-22)14-15-25(26)28(33)31-27(29(34)35)13-8-17-30/h6-7,9,12,14-15,19,22,27H,3-5,8,10-11,13,16-18,20,30H2,1-2H3,(H,31,33)(H,34,35) |
| InChIKey | YSFCGIFYSWAYMT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |