C30H41LiN2O4 — CID 20699199
lithium 2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-5-methoxypentanoate (PubChem CID 20699199) has the molecular formula C30H41LiN2O4 and a molecular weight of 500.61 g/mol. Its IUPAC name is lithium 2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-5-methoxypentanoate.
| Compound Name | lithium 2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-5-methoxypentanoate |
|---|---|
| PubChem CID | 20699199 |
| Molecular Formula | C30H41LiN2O4 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | lithium 2-[[4-[[2-cyclohexylethyl(methyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-5-methoxypentanoate |
| SMILES | COCCCC(NC(=O)c1ccc(CN(C)CCC2CCCCC2)cc1-c1ccccc1C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C30H42N2O4.Li/c1-22-10-7-8-13-25(22)27-20-24(21-32(2)18-17-23-11-5-4-6-12-23)15-16-26(27)29(33)31-28(30(34)35)14-9-19-36-3;/h7-8,10,13,15-16,20,23,28H,4-6,9,11-12,14,17-19,21H2,1-3H3,(H,31,33)(H,34,35);/q;+1/p-1 |
| InChIKey | VONMVIAQLITPBS-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|