C32H40N2O8S2 — CID 20623402
2-[[4-[[3-methoxypropylsulfonyl(2-phenylethyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 20623402) has the molecular formula C32H40N2O8S2 and a molecular weight of 644.81 g/mol. Its IUPAC name is 2-[[4-[[3-methoxypropylsulfonyl(2-phenylethyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[4-[[3-methoxypropylsulfonyl(2-phenylethyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 20623402 |
| Molecular Formula | C32H40N2O8S2 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 2-[[4-[[3-methoxypropylsulfonyl(2-phenylethyl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | COCCCS(=O)(=O)N(CCc1ccccc1)Cc1ccc(C(=O)NC(CCS(C)(=O)=O)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C32H40N2O8S2/c1-24-10-7-8-13-27(24)29-22-26(14-15-28(29)31(35)33-30(32(36)37)17-21-43(3,38)39)23-34(44(40,41)20-9-19-42-2)18-16-25-11-5-4-6-12-25/h4-8,10-15,22,30H,9,16-21,23H2,1-3H3,(H,33,35)(H,36,37) |
| InChIKey | BPQNQLCCJPRGQK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|