C27H29ClO3 — CID 70224929
methyl 4-[5-(3-chlorophenyl)pentoxymethyl]-2-(2-methylphenyl)benzoate (PubChem CID 70224929) has the molecular formula C27H29ClO3 and a molecular weight of 436.98 g/mol. Its IUPAC name is methyl 4-[5-(3-chlorophenyl)pentoxymethyl]-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-[5-(3-chlorophenyl)pentoxymethyl]-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 70224929 |
| Molecular Formula | C27H29ClO3 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl 4-[5-(3-chlorophenyl)pentoxymethyl]-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(COCCCCCc2cccc(Cl)c2)cc1-c1ccccc1C |
| InChI | InChI=1S/C27H29ClO3/c1-20-9-5-6-13-24(20)26-18-22(14-15-25(26)27(29)30-2)19-31-16-7-3-4-10-21-11-8-12-23(28)17-21/h5-6,8-9,11-15,17-18H,3-4,7,10,16,19H2,1-2H3 |
| InChIKey | TZWPHESFAKNOHU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|