C11H14ClNO3 — CID 14496167
methyl N-[2-[(3-chlorophenyl)methoxy]ethyl]carbamate (PubChem CID 14496167) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is methyl N-[2-[(3-chlorophenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3-chlorophenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 14496167 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | methyl N-[2-[(3-chlorophenyl)methoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO3/c1-15-11(14)13-5-6-16-8-9-3-2-4-10(12)7-9/h2-4,7H,5-6,8H2,1H3,(H,13,14) |
| InChIKey | DEYCWOIRTIUVJJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|