C19H24ClNO3 — CID 168947372
ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrole-3-carboxylate (PubChem CID 168947372) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168947372 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(C)c1CCCCOCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H24ClNO3/c1-3-24-19(22)17-10-11-21(2)18(17)9-4-5-12-23-14-15-7-6-8-16(20)13-15/h6-8,10-11,13H,3-5,9,12,14H2,1-2H3 |
| InChIKey | LBWUFXVJQJFQEN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|