C25H29Cl2N3O3 — CID 168947517
(3S)-5-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanamide (PubChem CID 168947517) has the molecular formula C25H29Cl2N3O3 and a molecular weight of 490.43 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanamide.
| Compound Name | (3S)-5-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 168947517 |
| Molecular Formula | C25H29Cl2N3O3 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (3S)-5-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanamide |
| SMILES | C[C@H](CC(N)=O)CC(=O)c1c(CCCCOCc2cccc(Cl)c2)n(C)c2ncc(Cl)cc12 |
| InChI | InChI=1S/C25H29Cl2N3O3/c1-16(11-23(28)32)10-22(31)24-20-13-19(27)14-29-25(20)30(2)21(24)8-3-4-9-33-15-17-6-5-7-18(26)12-17/h5-7,12-14,16H,3-4,8-11,15H2,1-2H3,(H2,28,32)/t16-/m0/s1 |
| InChIKey | KEXDJKQYLHLAKQ-INIZCTEOSA-N |
| XLogP | 5.50 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|