C24H28Cl2N2O4 — CID 168947195
(3R)-1-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-5,5-dihydroxy-3-methylpentan-1-one (PubChem CID 168947195) has the molecular formula C24H28Cl2N2O4 and a molecular weight of 479.40 g/mol. Its IUPAC name is (3R)-1-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-5,5-dihydroxy-3-methylpentan-1-one.
| Compound Name | (3R)-1-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-5,5-dihydroxy-3-methylpentan-1-one |
|---|---|
| PubChem CID | 168947195 |
| Molecular Formula | C24H28Cl2N2O4 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (3R)-1-[5-chloro-2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-5,5-dihydroxy-3-methylpentan-1-one |
| SMILES | C[C@@H](CC(=O)c1c(CCCCOCc2cccc(Cl)c2)[nH]c2ncc(Cl)cc12)CC(O)O |
| InChI | InChI=1S/C24H28Cl2N2O4/c1-15(10-22(30)31)9-21(29)23-19-12-18(26)13-27-24(19)28-20(23)7-2-3-8-32-14-16-5-4-6-17(25)11-16/h4-6,11-13,15,22,30-31H,2-3,7-10,14H2,1H3,(H,27,28)/t15-/m0/s1 |
| InChIKey | FGWJOVXUTWEGIB-HNNXBMFYSA-N |
| XLogP | 5.32 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|