C27H30ClN3O5 — CID 176742164
5-[2-[4-[(3-chlorophenyl)methoxy]butyl]-1-(2-hydroxyethyl)-5-isocyanopyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 176742164) has the molecular formula C27H30ClN3O5 and a molecular weight of 512.01 g/mol. Its IUPAC name is 5-[2-[4-[(3-chlorophenyl)methoxy]butyl]-1-(2-hydroxyethyl)-5-isocyanopyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[2-[4-[(3-chlorophenyl)methoxy]butyl]-1-(2-hydroxyethyl)-5-isocyanopyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 176742164 |
| Molecular Formula | C27H30ClN3O5 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 5-[2-[4-[(3-chlorophenyl)methoxy]butyl]-1-(2-hydroxyethyl)-5-isocyanopyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | [C-]#[N+]c1cnc2c(c1)c(C(=O)CC(C)CC(=O)O)c(CCCCOCc1cccc(Cl)c1)n2CCO |
| InChI | InChI=1S/C27H30ClN3O5/c1-18(13-25(34)35)12-24(33)26-22-15-21(29-2)16-30-27(22)31(9-10-32)23(26)8-3-4-11-36-17-19-6-5-7-20(28)14-19/h5-7,14-16,18,32H,3-4,8-13,17H2,1H3,(H,34,35) |
| InChIKey | CEUJPLLJABFQGD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|