C26H26ClN3O4 — CID 168947569
(3S)-5-[2-[(E)-4-[(3-chlorophenyl)methoxy]but-2-enyl]-5-cyano-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947569) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is (3S)-5-[2-[(E)-4-[(3-chlorophenyl)methoxy]but-2-enyl]-5-cyano-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[2-[(E)-4-[(3-chlorophenyl)methoxy]but-2-enyl]-5-cyano-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947569 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (3S)-5-[2-[(E)-4-[(3-chlorophenyl)methoxy]but-2-enyl]-5-cyano-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(C/C=C/COCc2cccc(Cl)c2)n(C)c2ncc(C#N)cc12 |
| InChI | InChI=1S/C26H26ClN3O4/c1-17(11-24(32)33)10-23(31)25-21-13-19(14-28)15-29-26(21)30(2)22(25)8-3-4-9-34-16-18-6-5-7-20(27)12-18/h3-7,12-13,15,17H,8-11,16H2,1-2H3,(H,32,33)/b4-3+/t17-/m0/s1 |
| InChIKey | LRGGTKVQZZZDDS-IDOMTICXSA-N |
| XLogP | 5.10 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|