C27H31F2N3O3 — CID 168947096
5-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947096) has the molecular formula C27H31F2N3O3 and a molecular weight of 483.56 g/mol. Its IUPAC name is 5-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947096 |
| Molecular Formula | C27H31F2N3O3 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 5-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)c1c(CCCCCCC#CC2CC(F)(F)C2)n(C)c2ncc(C#N)cc12 |
| InChI | InChI=1S/C27H31F2N3O3/c1-18(12-24(34)35)11-23(33)25-21-13-20(16-30)17-31-26(21)32(2)22(25)10-8-6-4-3-5-7-9-19-14-27(28,29)15-19/h13,17-19H,3-6,8,10-12,14-15H2,1-2H3,(H,34,35) |
| InChIKey | RTPIJPYTHIDJFN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|