C27H30ClN3O4 — CID 168947583
5-[5-chloro-2-[6-(3-cyanophenyl)-6-hydroxyhexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947583) has the molecular formula C27H30ClN3O4 and a molecular weight of 496.01 g/mol. Its IUPAC name is 5-[5-chloro-2-[6-(3-cyanophenyl)-6-hydroxyhexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[5-chloro-2-[6-(3-cyanophenyl)-6-hydroxyhexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947583 |
| Molecular Formula | C27H30ClN3O4 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 5-[5-chloro-2-[6-(3-cyanophenyl)-6-hydroxyhexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)c1c(CCCCCC(O)c2cccc(C#N)c2)n(C)c2ncc(Cl)cc12 |
| InChI | InChI=1S/C27H30ClN3O4/c1-17(12-25(34)35)11-24(33)26-21-14-20(28)16-30-27(21)31(2)22(26)9-4-3-5-10-23(32)19-8-6-7-18(13-19)15-29/h6-8,13-14,16-17,23,32H,3-5,9-12H2,1-2H3,(H,34,35) |
| InChIKey | LVCGHOXIFYVWRN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|