C24H28ClN2O4+ — CID 176742198
(3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-pyrrolo[2,3-b]pyridin-1-ium-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 176742198) has the molecular formula C24H28ClN2O4+ and a molecular weight of 443.95 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-pyrrolo[2,3-b]pyridin-1-ium-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-pyrrolo[2,3-b]pyridin-1-ium-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 176742198 |
| Molecular Formula | C24H28ClN2O4+ |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-pyrrolo[2,3-b]pyridin-1-ium-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)C1C(CCCC(O)c2ccccc2)=[N+](C)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C24H27ClN2O4/c1-15(12-22(30)31)11-21(29)23-18-13-17(25)14-26-24(18)27(2)19(23)9-6-10-20(28)16-7-4-3-5-8-16/h3-5,7-8,13-15,20,23,28H,6,9-12H2,1-2H3/p+1/t15-,20?,23?/m0/s1 |
| InChIKey | SJNJQFLGPRUXAI-VVWGJOJXSA-O |
| XLogP | 4.52 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|