C25H29ClNO4+ — CID 176742254
(3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-indol-1-ium-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 176742254) has the molecular formula C25H29ClNO4+ and a molecular weight of 442.96 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-indol-1-ium-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-indol-1-ium-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 176742254 |
| Molecular Formula | C25H29ClNO4+ |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (3S)-5-[5-chloro-2-(4-hydroxy-4-phenylbutyl)-1-methyl-3H-indol-1-ium-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)C1C(CCCC(O)c2ccccc2)=[N+](C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H28ClNO4/c1-16(14-24(30)31)13-23(29)25-19-15-18(26)11-12-20(19)27(2)21(25)9-6-10-22(28)17-7-4-3-5-8-17/h3-5,7-8,11-12,15-16,22,25,28H,6,9-10,13-14H2,1-2H3/p+1/t16-,22?,25?/m0/s1 |
| InChIKey | LYTATBCSHZJWPV-FPXRNPNWSA-O |
| XLogP | 5.13 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|