C27H31Cl2NO4 — CID 168947336
(3S)-5-[5-chloro-2-[6-(3-chlorophenyl)-6-hydroxyhexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947336) has the molecular formula C27H31Cl2NO4 and a molecular weight of 504.45 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)-6-hydroxyhexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)-6-hydroxyhexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947336 |
| Molecular Formula | C27H31Cl2NO4 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)-6-hydroxyhexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(CCCCCC(O)c2cccc(Cl)c2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H31Cl2NO4/c1-17(14-26(33)34)13-25(32)27-21-16-20(29)11-12-22(21)30(2)23(27)9-4-3-5-10-24(31)18-7-6-8-19(28)15-18/h6-8,11-12,15-17,24,31H,3-5,9-10,13-14H2,1-2H3,(H,33,34)/t17-,24?/m0/s1 |
| InChIKey | VNNVEPRUVDQZGG-KEJDIYNNSA-N |
| XLogP | 7.01 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|