C21H28ClNO3 — CID 134384450
methyl 5-(5-chloro-1-methyl-2-pentylindol-3-yl)-3-methyl-5-oxopentanoate (PubChem CID 134384450) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is methyl 5-(5-chloro-1-methyl-2-pentylindol-3-yl)-3-methyl-5-oxopentanoate.
| Compound Name | methyl 5-(5-chloro-1-methyl-2-pentylindol-3-yl)-3-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 134384450 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | methyl 5-(5-chloro-1-methyl-2-pentylindol-3-yl)-3-methyl-5-oxopentanoate |
| SMILES | CCCCCc1c(C(=O)CC(C)CC(=O)OC)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C21H28ClNO3/c1-5-6-7-8-18-21(19(24)11-14(2)12-20(25)26-4)16-13-15(22)9-10-17(16)23(18)3/h9-10,13-14H,5-8,11-12H2,1-4H3 |
| InChIKey | IVQSBDAFSXVIJS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|