C26H32ClNO4 — CID 168947360
5-[5-chloro-1-methyl-2-[8-(oxetan-3-yl)oct-7-ynyl]indol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947360) has the molecular formula C26H32ClNO4 and a molecular weight of 458.00 g/mol. Its IUPAC name is 5-[5-chloro-1-methyl-2-[8-(oxetan-3-yl)oct-7-ynyl]indol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[5-chloro-1-methyl-2-[8-(oxetan-3-yl)oct-7-ynyl]indol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947360 |
| Molecular Formula | C26H32ClNO4 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 5-[5-chloro-1-methyl-2-[8-(oxetan-3-yl)oct-7-ynyl]indol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)c1c(CCCCCCC#CC2COC2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H32ClNO4/c1-18(14-25(30)31)13-24(29)26-21-15-20(27)11-12-22(21)28(2)23(26)10-8-6-4-3-5-7-9-19-16-32-17-19/h11-12,15,18-19H,3-6,8,10,13-14,16-17H2,1-2H3,(H,30,31) |
| InChIKey | SRJXWGLPMIRJCH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|