C27H32ClF2NO3 — CID 168947669
5-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947669) has the molecular formula C27H32ClF2NO3 and a molecular weight of 492.01 g/mol. Its IUPAC name is 5-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947669 |
| Molecular Formula | C27H32ClF2NO3 |
| Molecular Weight | 492.01 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 5-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)c1c(CCCCCCC#CC2CC(F)(F)C2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H32ClF2NO3/c1-18(14-25(33)34)13-24(32)26-21-15-20(28)11-12-22(21)31(2)23(26)10-8-6-4-3-5-7-9-19-16-27(29,30)17-19/h11-12,15,18-19H,3-6,8,10,13-14,16-17H2,1-2H3,(H,33,34) |
| InChIKey | GACDZVZWGKMAIB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.01 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|