C27H34ClF2N5O — CID 168947623
(3R)-1-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-4-(2,3-dihydro-1H-tetrazol-5-yl)-3-methylbutan-1-one (PubChem CID 168947623) has the molecular formula C27H34ClF2N5O and a molecular weight of 518.05 g/mol. Its IUPAC name is (3R)-1-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-4-(2,3-dihydro-1H-tetrazol-5-yl)-3-methylbutan-1-one.
| Compound Name | (3R)-1-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-4-(2,3-dihydro-1H-tetrazol-5-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 168947623 |
| Molecular Formula | C27H34ClF2N5O |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (3R)-1-[5-chloro-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylindol-3-yl]-4-(2,3-dihydro-1H-tetrazol-5-yl)-3-methylbutan-1-one |
| SMILES | C[C@@H](CC(=O)c1c(CCCCCCC#CC2CC(F)(F)C2)n(C)c2ccc(Cl)cc12)CC1=NNNN1 |
| InChI | InChI=1S/C27H34ClF2N5O/c1-18(14-25-31-33-34-32-25)13-24(36)26-21-15-20(28)11-12-22(21)35(2)23(26)10-8-6-4-3-5-7-9-19-16-27(29,30)17-19/h11-12,15,18-19,33-34H,3-6,8,10,13-14,16-17H2,1-2H3,(H,31,32)/t18-/m0/s1 |
| InChIKey | XEDOUTQXKCZMCY-SFHVURJKSA-N |
| XLogP | 5.90 |
| TPSA | 70.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|