C25H29ClF3NO3 — CID 168947343
(3S)-5-[5-chloro-1-methyl-2-(10,10,10-trifluorodec-7-ynyl)indol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947343) has the molecular formula C25H29ClF3NO3 and a molecular weight of 483.96 g/mol. Its IUPAC name is (3S)-5-[5-chloro-1-methyl-2-(10,10,10-trifluorodec-7-ynyl)indol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-chloro-1-methyl-2-(10,10,10-trifluorodec-7-ynyl)indol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947343 |
| Molecular Formula | C25H29ClF3NO3 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (3S)-5-[5-chloro-1-methyl-2-(10,10,10-trifluorodec-7-ynyl)indol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(CCCCCCC#CCC(F)(F)F)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H29ClF3NO3/c1-17(15-23(32)33)14-22(31)24-19-16-18(26)11-12-20(19)30(2)21(24)10-8-6-4-3-5-7-9-13-25(27,28)29/h11-12,16-17H,3-6,8,10,13-15H2,1-2H3,(H,32,33)/t17-/m0/s1 |
| InChIKey | VOFPFFWNJGENPG-KRWDZBQOSA-N |
| XLogP | 6.96 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|