C27H31ClFNO3 — CID 122600359
(3R)-5-[5-chloro-2-[6-(2-fluorophenyl)hexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 122600359) has the molecular formula C27H31ClFNO3 and a molecular weight of 472.00 g/mol. Its IUPAC name is (3R)-5-[5-chloro-2-[6-(2-fluorophenyl)hexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3R)-5-[5-chloro-2-[6-(2-fluorophenyl)hexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 122600359 |
| Molecular Formula | C27H31ClFNO3 |
| Molecular Weight | 472.00 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (3R)-5-[5-chloro-2-[6-(2-fluorophenyl)hexyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@@H](CC(=O)O)CC(=O)c1c(CCCCCCc2ccccc2F)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H31ClFNO3/c1-18(16-26(32)33)15-25(31)27-21-17-20(28)13-14-23(21)30(2)24(27)12-6-4-3-5-9-19-10-7-8-11-22(19)29/h7-8,10-11,13-14,17-18H,3-6,9,12,15-16H2,1-2H3,(H,32,33)/t18-/m1/s1 |
| InChIKey | IVEHERBKHIBKAB-GOSISDBHSA-N |
| XLogP | 7.00 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.00 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|