C28H36Cl2N2O3 — CID 168947504
(3S)-5-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid;ethane (PubChem CID 168947504) has the molecular formula C28H36Cl2N2O3 and a molecular weight of 519.51 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid;ethane.
| Compound Name | (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 168947504 |
| Molecular Formula | C28H36Cl2N2O3 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (3S)-5-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid;ethane |
| SMILES | CC.C[C@H](CC(=O)O)CC(=O)c1c(CCCCCCc2cccc(Cl)c2)n(C)c2ncc(Cl)cc12 |
| InChI | InChI=1S/C26H30Cl2N2O3.C2H6/c1-17(13-24(32)33)12-23(31)25-21-15-20(28)16-29-26(21)30(2)22(25)11-6-4-3-5-8-18-9-7-10-19(27)14-18;1-2/h7,9-10,14-17H,3-6,8,11-13H2,1-2H3,(H,32,33);1-2H3/t17-;/m0./s1 |
| InChIKey | RHGOVWBSEWEITE-LMOVPXPDSA-N |
| XLogP | 7.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|