C30H41Cl2N3O3 — CID 168947255
(3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid;ethane (PubChem CID 168947255) has the molecular formula C30H41Cl2N3O3 and a molecular weight of 562.58 g/mol. Its IUPAC name is (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid;ethane.
| Compound Name | (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 168947255 |
| Molecular Formula | C30H41Cl2N3O3 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid;ethane |
| SMILES | CC.CC.Cn1c(CCCCCCc2cccc(Cl)c2)c(C(=O)N2CC[C@H](C(=O)O)C2)c2cc(Cl)cnc21 |
| InChI | InChI=1S/C26H29Cl2N3O3.2C2H6/c1-30-22(10-5-3-2-4-7-17-8-6-9-19(27)13-17)23(21-14-20(28)15-29-24(21)30)25(32)31-12-11-18(16-31)26(33)34;2*1-2/h6,8-9,13-15,18H,2-5,7,10-12,16H2,1H3,(H,33,34);2*1-2H3/t18-;;/m0../s1 |
| InChIKey | KLIJXBKPYMNHPA-NTEVMMBTSA-N |
| XLogP | 7.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|