C28H32Cl2N2O3 — CID 168947133
(3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylindole-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 168947133) has the molecular formula C28H32Cl2N2O3 and a molecular weight of 515.48 g/mol. Its IUPAC name is (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylindole-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylindole-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168947133 |
| Molecular Formula | C28H32Cl2N2O3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (3S)-1-[5-chloro-2-[6-(3-chlorophenyl)hexyl]-1-methylindole-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | Cn1c(CCCCCCc2cccc(Cl)c2)c(C(=O)N2CCC[C@H](C(=O)O)C2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H32Cl2N2O3/c1-31-24-14-13-22(30)17-23(24)26(27(33)32-15-7-10-20(18-32)28(34)35)25(31)12-5-3-2-4-8-19-9-6-11-21(29)16-19/h6,9,11,13-14,16-17,20H,2-5,7-8,10,12,15,18H2,1H3,(H,34,35)/t20-/m0/s1 |
| InChIKey | JJGUJOYGEBYPTN-FQEVSTJZSA-N |
| XLogP | 6.77 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|