C16H17ClN2O3 — CID 124696894
(3R)-1-(3-chloro-1-methylindole-2-carbonyl)piperidine-3-carboxylic acid (PubChem CID 124696894) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is (3R)-1-(3-chloro-1-methylindole-2-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(3-chloro-1-methylindole-2-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124696894 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (3R)-1-(3-chloro-1-methylindole-2-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cn1c(C(=O)N2CCC[C@@H](C(=O)O)C2)c(Cl)c2ccccc21 |
| InChI | InChI=1S/C16H17ClN2O3/c1-18-12-7-3-2-6-11(12)13(17)14(18)15(20)19-8-4-5-10(9-19)16(21)22/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | XSHPTZQJSFTOII-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |