C17H16ClNO4 — CID 119113435
(3S)-1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-3-carboxylic acid (PubChem CID 119113435) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is (3S)-1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113435 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (3S)-1-[5-(2-chlorophenyl)furan-2-carbonyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2ccc(-c3ccccc3Cl)o2)C1 |
| InChI | InChI=1S/C17H16ClNO4/c18-13-6-2-1-5-12(13)14-7-8-15(23-14)16(20)19-9-3-4-11(10-19)17(21)22/h1-2,5-8,11H,3-4,9-10H2,(H,21,22)/t11-/m0/s1 |
| InChIKey | GZYNMIDSINQSAQ-NSHDSACASA-N |
| XLogP | 3.54 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |