C17H18ClNO4 — CID 56888923
[5-(2-chlorophenyl)furan-2-yl]-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 56888923) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is [5-(2-chlorophenyl)furan-2-yl]-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [5-(2-chlorophenyl)furan-2-yl]-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56888923 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [5-(2-chlorophenyl)furan-2-yl]-[3-hydroxy-3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2Cl)o1)N1CCCC(O)(CO)C1 |
| InChI | InChI=1S/C17H18ClNO4/c18-13-5-2-1-4-12(13)14-6-7-15(23-14)16(21)19-9-3-8-17(22,10-19)11-20/h1-2,4-7,20,22H,3,8-11H2 |
| InChIKey | BVARSLWEYVPTOD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |